C18H13N2O5S- — CID 3519718
6-(2,3-dihydroindol-1-ylsulfonyl)-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 3519718) has the molecular formula C18H13N2O5S- and a molecular weight of 369.38 g/mol. Its IUPAC name is 6-(2,3-dihydroindol-1-ylsulfonyl)-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | 6-(2,3-dihydroindol-1-ylsulfonyl)-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3519718 |
| Molecular Formula | C18H13N2O5S- |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 6-(2,3-dihydroindol-1-ylsulfonyl)-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | O=C([O-])c1c[nH]c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2c1=O |
| InChI | InChI=1S/C18H14N2O5S/c21-17-13-9-12(5-6-15(13)19-10-14(17)18(22)23)26(24,25)20-8-7-11-3-1-2-4-16(11)20/h1-6,9-10H,7-8H2,(H,19,21)(H,22,23)/p-1 |
| InChIKey | RWXJDJTXOGWKFG-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |