C18H16N2O5S — CID 3513999
6-[ethyl(phenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 3513999) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 6-[ethyl(phenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-[ethyl(phenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 3513999 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 6-[ethyl(phenyl)sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc2[nH]cc(C(=O)O)c(=O)c2c1 |
| InChI | InChI=1S/C18H16N2O5S/c1-2-20(12-6-4-3-5-7-12)26(24,25)13-8-9-16-14(10-13)17(21)15(11-19-16)18(22)23/h3-11H,2H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | LDHNZGZCXFICKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |