C16H14N2O4S — CID 100820451
N-ethyl-1,3-dioxo-N-phenylisoindole-5-sulfonamide (PubChem CID 100820451) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-ethyl-1,3-dioxo-N-phenylisoindole-5-sulfonamide.
| Compound Name | N-ethyl-1,3-dioxo-N-phenylisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 100820451 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-ethyl-1,3-dioxo-N-phenylisoindole-5-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C16H14N2O4S/c1-2-18(11-6-4-3-5-7-11)23(21,22)12-8-9-13-14(10-12)16(20)17-15(13)19/h3-10H,2H2,1H3,(H,17,19,20) |
| InChIKey | NHIBALBYWNSQNN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|