C23H20FN3O5S — CID 4620966
6-[ethyl-(4-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 4620966) has the molecular formula C23H20FN3O5S and a molecular weight of 469.49 g/mol. Its IUPAC name is 6-[ethyl-(4-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | 6-[ethyl-(4-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 4620966 |
| Molecular Formula | C23H20FN3O5S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 6-[ethyl-(4-fluorophenyl)sulfamoyl]-N-(furan-2-ylmethyl)-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CCN(c1ccc(F)cc1)S(=O)(=O)c1ccc2[nH]cc(C(=O)NCc3ccco3)c(=O)c2c1 |
| InChI | InChI=1S/C23H20FN3O5S/c1-2-27(16-7-5-15(24)6-8-16)33(30,31)18-9-10-21-19(12-18)22(28)20(14-25-21)23(29)26-13-17-4-3-11-32-17/h3-12,14H,2,13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | ZBMTXMKPFAMIDM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |