C25H29N3O4S — CID 3519999
N-hexyl-4-oxo-6-[phenyl(prop-2-enyl)sulfamoyl]-1H-quinoline-3-carboxamide (PubChem CID 3519999) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-hexyl-4-oxo-6-[phenyl(prop-2-enyl)sulfamoyl]-1H-quinoline-3-carboxamide.
| Compound Name | N-hexyl-4-oxo-6-[phenyl(prop-2-enyl)sulfamoyl]-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 3519999 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-hexyl-4-oxo-6-[phenyl(prop-2-enyl)sulfamoyl]-1H-quinoline-3-carboxamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1ccc2[nH]cc(C(=O)NCCCCCC)c(=O)c2c1 |
| InChI | InChI=1S/C25H29N3O4S/c1-3-5-6-10-15-26-25(30)22-18-27-23-14-13-20(17-21(23)24(22)29)33(31,32)28(16-4-2)19-11-8-7-9-12-19/h4,7-9,11-14,17-18H,2-3,5-6,10,15-16H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | KGCJZLYCSFYTSG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|