C15H15N3O9S3 — CID 118347006
5-[[(2-methylsulfonyl-3H-benzimidazol-5-yl)amino]methoxy]benzene-1,3-disulfonic acid (PubChem CID 118347006) has the molecular formula C15H15N3O9S3 and a molecular weight of 477.50 g/mol. Its IUPAC name is 5-[[(2-methylsulfonyl-3H-benzimidazol-5-yl)amino]methoxy]benzene-1,3-disulfonic acid.
| Compound Name | 5-[[(2-methylsulfonyl-3H-benzimidazol-5-yl)amino]methoxy]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 118347006 |
| Molecular Formula | C15H15N3O9S3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | 5-[[(2-methylsulfonyl-3H-benzimidazol-5-yl)amino]methoxy]benzene-1,3-disulfonic acid |
| SMILES | CS(=O)(=O)c1nc2ccc(NCOc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3)cc2[nH]1 |
| InChI | InChI=1S/C15H15N3O9S3/c1-28(19,20)15-17-13-3-2-9(4-14(13)18-15)16-8-27-10-5-11(29(21,22)23)7-12(6-10)30(24,25)26/h2-7,16H,8H2,1H3,(H,17,18)(H,21,22,23)(H,24,25,26) |
| InChIKey | YBTMUDUUOIWLEG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|