C18H11F3N2O — CID 155599071
2-naphthalen-1-yl-6-(trifluoromethoxy)-1H-benzimidazole (PubChem CID 155599071) has the molecular formula C18H11F3N2O and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-naphthalen-1-yl-6-(trifluoromethoxy)-1H-benzimidazole.
| Compound Name | 2-naphthalen-1-yl-6-(trifluoromethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 155599071 |
| Molecular Formula | C18H11F3N2O |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-naphthalen-1-yl-6-(trifluoromethoxy)-1H-benzimidazole |
| SMILES | FC(F)(F)Oc1ccc2nc(-c3cccc4ccccc34)[nH]c2c1 |
| InChI | InChI=1S/C18H11F3N2O/c19-18(20,21)24-12-8-9-15-16(10-12)23-17(22-15)14-7-3-5-11-4-1-2-6-13(11)14/h1-10H,(H,22,23) |
| InChIKey | CYNPRVPNOGBOBI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |