C11H7ClF3NO — CID 121236449
3-chloro-2-methyl-7-(trifluoromethyl)-1H-quinolin-4-one (PubChem CID 121236449) has the molecular formula C11H7ClF3NO and a molecular weight of 261.63 g/mol. Its IUPAC name is 3-chloro-2-methyl-7-(trifluoromethyl)-1H-quinolin-4-one.
| Compound Name | 3-chloro-2-methyl-7-(trifluoromethyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 121236449 |
| Molecular Formula | C11H7ClF3NO |
| Molecular Weight | 261.63 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 3-chloro-2-methyl-7-(trifluoromethyl)-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2cc(C(F)(F)F)ccc2c(=O)c1Cl |
| InChI | InChI=1S/C11H7ClF3NO/c1-5-9(12)10(17)7-3-2-6(11(13,14)15)4-8(7)16-5/h2-4H,1H3,(H,16,17) |
| InChIKey | RSAOIZMNDXXGKZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |