C13H11F3N4 — CID 136986200
5-[2-methyl-6-(trifluoromethyl)-1H-indol-3-yl]-1H-pyrazol-4-amine (PubChem CID 136986200) has the molecular formula C13H11F3N4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 5-[2-methyl-6-(trifluoromethyl)-1H-indol-3-yl]-1H-pyrazol-4-amine.
| Compound Name | 5-[2-methyl-6-(trifluoromethyl)-1H-indol-3-yl]-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 136986200 |
| Molecular Formula | C13H11F3N4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-[2-methyl-6-(trifluoromethyl)-1H-indol-3-yl]-1H-pyrazol-4-amine |
| SMILES | Cc1[nH]c2cc(C(F)(F)F)ccc2c1-c1[nH]ncc1N |
| InChI | InChI=1S/C13H11F3N4/c1-6-11(12-9(17)5-18-20-12)8-3-2-7(13(14,15)16)4-10(8)19-6/h2-5,19H,17H2,1H3,(H,18,20) |
| InChIKey | YWBKUJPHXVBETJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |