C14H13F3N4 — CID 115108997
5-[1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]-1H-pyrazol-4-amine (PubChem CID 115108997) has the molecular formula C14H13F3N4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 5-[1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]-1H-pyrazol-4-amine.
| Compound Name | 5-[1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 115108997 |
| Molecular Formula | C14H13F3N4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5-[1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]-1H-pyrazol-4-amine |
| SMILES | Cc1c(-c2[nH]ncc2N)c2cc(C(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C14H13F3N4/c1-7-12(13-10(18)6-19-20-13)9-5-8(14(15,16)17)3-4-11(9)21(7)2/h3-6H,18H2,1-2H3,(H,19,20) |
| InChIKey | LPZROUGIVCBTPB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |