C17H21N3O — CID 84743563
3-(5-tert-butyl-1,2-dimethylindol-3-yl)-1,2-oxazol-5-amine (PubChem CID 84743563) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,2-dimethylindol-3-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-(5-tert-butyl-1,2-dimethylindol-3-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 84743563 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-(5-tert-butyl-1,2-dimethylindol-3-yl)-1,2-oxazol-5-amine |
| SMILES | Cc1c(-c2cc(N)on2)c2cc(C(C)(C)C)ccc2n1C |
| InChI | InChI=1S/C17H21N3O/c1-10-16(13-9-15(18)21-19-13)12-8-11(17(2,3)4)6-7-14(12)20(10)5/h6-9H,18H2,1-5H3 |
| InChIKey | XNEOXZFHJXMEOV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |