C13H13N3O2 — CID 115108539
3-(5-amino-1,2-oxazol-3-yl)-1,2-dimethylindol-7-ol (PubChem CID 115108539) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-(5-amino-1,2-oxazol-3-yl)-1,2-dimethylindol-7-ol.
| Compound Name | 3-(5-amino-1,2-oxazol-3-yl)-1,2-dimethylindol-7-ol |
|---|---|
| PubChem CID | 115108539 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(5-amino-1,2-oxazol-3-yl)-1,2-dimethylindol-7-ol |
| SMILES | Cc1c(-c2cc(N)on2)c2cccc(O)c2n1C |
| InChI | InChI=1S/C13H13N3O2/c1-7-12(9-6-11(14)18-15-9)8-4-3-5-10(17)13(8)16(7)2/h3-6,17H,14H2,1-2H3 |
| InChIKey | YQAGPYDTKNHWMA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |