C16H17N3 — CID 115110486
6-(1,2,7-trimethylindol-3-yl)pyridin-3-amine (PubChem CID 115110486) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 6-(1,2,7-trimethylindol-3-yl)pyridin-3-amine.
| Compound Name | 6-(1,2,7-trimethylindol-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 115110486 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 6-(1,2,7-trimethylindol-3-yl)pyridin-3-amine |
| SMILES | Cc1cccc2c(-c3ccc(N)cn3)c(C)n(C)c12 |
| InChI | InChI=1S/C16H17N3/c1-10-5-4-6-13-15(11(2)19(3)16(10)13)14-8-7-12(17)9-18-14/h4-9H,17H2,1-3H3 |
| InChIKey | VDWIOSBTZKMFSA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |