C15H17N3O — CID 84742247
5-(5-ethyl-1,2-dimethylindol-3-yl)-1,2-oxazol-3-amine (PubChem CID 84742247) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-(5-ethyl-1,2-dimethylindol-3-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(5-ethyl-1,2-dimethylindol-3-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 84742247 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5-(5-ethyl-1,2-dimethylindol-3-yl)-1,2-oxazol-3-amine |
| SMILES | CCc1ccc2c(c1)c(-c1cc(N)no1)c(C)n2C |
| InChI | InChI=1S/C15H17N3O/c1-4-10-5-6-12-11(7-10)15(9(2)18(12)3)13-8-14(16)17-19-13/h5-8H,4H2,1-3H3,(H2,16,17) |
| InChIKey | WQXSREZPLHGLOV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |