C14H9ClF7NO — CID 141395526
3-chloro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,8-dimethyl-1H-quinolin-4-one (PubChem CID 141395526) has the molecular formula C14H9ClF7NO and a molecular weight of 375.67 g/mol. Its IUPAC name is 3-chloro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,8-dimethyl-1H-quinolin-4-one.
| Compound Name | 3-chloro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,8-dimethyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 141395526 |
| Molecular Formula | C14H9ClF7NO |
| Molecular Weight | 375.67 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 3-chloro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,8-dimethyl-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2c(=O)c1Cl |
| InChI | InChI=1S/C14H9ClF7NO/c1-5-3-7(12(16,13(17,18)19)14(20,21)22)4-8-10(5)23-6(2)9(15)11(8)24/h3-4H,1-2H3,(H,23,24) |
| InChIKey | SNAILMJXAWRMET-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |