C12H6F7NO — CID 174912605
6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-quinolin-4-one (PubChem CID 174912605) has the molecular formula C12H6F7NO and a molecular weight of 313.17 g/mol. Its IUPAC name is 6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-quinolin-4-one.
| Compound Name | 6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 174912605 |
| Molecular Formula | C12H6F7NO |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-quinolin-4-one |
| SMILES | O=c1cc[nH]c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc12 |
| InChI | InChI=1S/C12H6F7NO/c13-10(11(14,15)16,12(17,18)19)6-1-2-8-7(5-6)9(21)3-4-20-8/h1-5H,(H,20,21) |
| InChIKey | UOADUNDMGTUZTP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |