C8H4F7NO — CID 172849751
5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one (PubChem CID 172849751) has the molecular formula C8H4F7NO and a molecular weight of 263.11 g/mol. Its IUPAC name is 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one.
| Compound Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 172849751 |
| Molecular Formula | C8H4F7NO |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1H-pyridin-2-one |
| SMILES | O=c1ccc(C(F)(C(F)(F)F)C(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C8H4F7NO/c9-6(7(10,11)12,8(13,14)15)4-1-2-5(17)16-3-4/h1-3H,(H,16,17) |
| InChIKey | XXGLEHIDUPYLEN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |