C17H14ClNO — CID 104845926
6-chloro-3,8-dimethyl-2-phenyl-1H-quinolin-4-one (PubChem CID 104845926) has the molecular formula C17H14ClNO and a molecular weight of 283.76 g/mol. Its IUPAC name is 6-chloro-3,8-dimethyl-2-phenyl-1H-quinolin-4-one.
| Compound Name | 6-chloro-3,8-dimethyl-2-phenyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 104845926 |
| Molecular Formula | C17H14ClNO |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 6-chloro-3,8-dimethyl-2-phenyl-1H-quinolin-4-one |
| SMILES | Cc1c(-c2ccccc2)[nH]c2c(C)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C17H14ClNO/c1-10-8-13(18)9-14-15(10)19-16(11(2)17(14)20)12-6-4-3-5-7-12/h3-9H,1-2H3,(H,19,20) |
| InChIKey | GHTAZYCISURLTD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |