C19H19NO — CID 104845936
3-methyl-2-phenyl-8-propyl-1H-quinolin-4-one (PubChem CID 104845936) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-methyl-2-phenyl-8-propyl-1H-quinolin-4-one.
| Compound Name | 3-methyl-2-phenyl-8-propyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 104845936 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-methyl-2-phenyl-8-propyl-1H-quinolin-4-one |
| SMILES | CCCc1cccc2c(=O)c(C)c(-c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C19H19NO/c1-3-8-14-11-7-12-16-18(14)20-17(13(2)19(16)21)15-9-5-4-6-10-15/h4-7,9-12H,3,8H2,1-2H3,(H,20,21) |
| InChIKey | CCJOTSFFOUYHGG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |