C18H13NO3 — CID 139613810
5,8-dimethyl-7-phenyl-6H-furo[3,4-e]indole-1,3-dione (PubChem CID 139613810) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 5,8-dimethyl-7-phenyl-6H-furo[3,4-e]indole-1,3-dione.
| Compound Name | 5,8-dimethyl-7-phenyl-6H-furo[3,4-e]indole-1,3-dione |
|---|---|
| PubChem CID | 139613810 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5,8-dimethyl-7-phenyl-6H-furo[3,4-e]indole-1,3-dione |
| SMILES | Cc1cc2c(c3c(C)c(-c4ccccc4)[nH]c13)C(=O)OC2=O |
| InChI | InChI=1S/C18H13NO3/c1-9-8-12-14(18(21)22-17(12)20)13-10(2)16(19-15(9)13)11-6-4-3-5-7-11/h3-8,19H,1-2H3 |
| InChIKey | VBVQFXTZXIUHAD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|