C11H5F6NO3 — CID 174892182
6-(trifluoromethoxy)-2-(trifluoromethyl)-1H-indole-3-carboxylic acid (PubChem CID 174892182) has the molecular formula C11H5F6NO3 and a molecular weight of 313.15 g/mol. Its IUPAC name is 6-(trifluoromethoxy)-2-(trifluoromethyl)-1H-indole-3-carboxylic acid.
| Compound Name | 6-(trifluoromethoxy)-2-(trifluoromethyl)-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 174892182 |
| Molecular Formula | C11H5F6NO3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 6-(trifluoromethoxy)-2-(trifluoromethyl)-1H-indole-3-carboxylic acid |
| SMILES | O=C(O)c1c(C(F)(F)F)[nH]c2cc(OC(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H5F6NO3/c12-10(13,14)8-7(9(19)20)5-2-1-4(3-6(5)18-8)21-11(15,16)17/h1-3,18H,(H,19,20) |
| InChIKey | QMAUUPRJJHIUFF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |