C11H11F3N2O — CID 83678476
[6-methoxy-2-(trifluoromethyl)-1H-indol-3-yl]methanamine (PubChem CID 83678476) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is [6-methoxy-2-(trifluoromethyl)-1H-indol-3-yl]methanamine.
| Compound Name | [6-methoxy-2-(trifluoromethyl)-1H-indol-3-yl]methanamine |
|---|---|
| PubChem CID | 83678476 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [6-methoxy-2-(trifluoromethyl)-1H-indol-3-yl]methanamine |
| SMILES | COc1ccc2c(CN)c(C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C11H11F3N2O/c1-17-6-2-3-7-8(5-15)10(11(12,13)14)16-9(7)4-6/h2-4,16H,5,15H2,1H3 |
| InChIKey | YFCATRWDASKJPU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |