C22H34N3O+ — CID 4050752
6-(diethylamino)-3-[(2-ethylpiperidin-1-ium-1-yl)methyl]-2-methyl-1H-quinolin-4-one (PubChem CID 4050752) has the molecular formula C22H34N3O+ and a molecular weight of 356.53 g/mol. Its IUPAC name is 6-(diethylamino)-3-[(2-ethylpiperidin-1-ium-1-yl)methyl]-2-methyl-1H-quinolin-4-one.
| Compound Name | 6-(diethylamino)-3-[(2-ethylpiperidin-1-ium-1-yl)methyl]-2-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 4050752 |
| Molecular Formula | C22H34N3O+ |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 6-(diethylamino)-3-[(2-ethylpiperidin-1-ium-1-yl)methyl]-2-methyl-1H-quinolin-4-one |
| SMILES | CCC1CCCC[NH+]1Cc1c(C)[nH]c2ccc(N(CC)CC)cc2c1=O |
| InChI | InChI=1S/C22H33N3O/c1-5-17-10-8-9-13-25(17)15-20-16(4)23-21-12-11-18(24(6-2)7-3)14-19(21)22(20)26/h11-12,14,17H,5-10,13,15H2,1-4H3,(H,23,26)/p+1 |
| InChIKey | OHEYTYLJKWSRBY-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |