C16H18O3 — CID 86035847
2,2,8,8-tetramethylpyrano[3,2-g]chromen-5-ol (PubChem CID 86035847) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,2,8,8-tetramethylpyrano[3,2-g]chromen-5-ol.
| Compound Name | 2,2,8,8-tetramethylpyrano[3,2-g]chromen-5-ol |
|---|---|
| PubChem CID | 86035847 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2,2,8,8-tetramethylpyrano[3,2-g]chromen-5-ol |
| SMILES | CC1(C)C=Cc2c(cc3c(c2O)C=CC(C)(C)O3)O1 |
| InChI | InChI=1S/C16H18O3/c1-15(2)7-5-10-12(18-15)9-13-11(14(10)17)6-8-16(3,4)19-13/h5-9,17H,1-4H3 |
| InChIKey | XVLWJKPYEKBBOP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |