C20H18O7 — CID 71473387
(7R,8R)-8-(2,4-dihydroxyphenyl)-5,7-dihydroxy-2,2-dimethyl-7,8-dihydropyrano[3,2-g]chromen-6-one (PubChem CID 71473387) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is (7R,8R)-8-(2,4-dihydroxyphenyl)-5,7-dihydroxy-2,2-dimethyl-7,8-dihydropyrano[3,2-g]chromen-6-one.
| Compound Name | (7R,8R)-8-(2,4-dihydroxyphenyl)-5,7-dihydroxy-2,2-dimethyl-7,8-dihydropyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 71473387 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (7R,8R)-8-(2,4-dihydroxyphenyl)-5,7-dihydroxy-2,2-dimethyl-7,8-dihydropyrano[3,2-g]chromen-6-one |
| SMILES | CC1(C)C=Cc2c(cc3c(c2O)C(=O)[C@H](O)[C@@H](c2ccc(O)cc2O)O3)O1 |
| InChI | InChI=1S/C20H18O7/c1-20(2)6-5-11-13(27-20)8-14-15(16(11)23)17(24)18(25)19(26-14)10-4-3-9(21)7-12(10)22/h3-8,18-19,21-23,25H,1-2H3/t18-,19+/m0/s1 |
| InChIKey | SQEVPBLXSXPBPD-RBUKOAKNSA-N |
| XLogP | 2.66 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |