C17H18O3 — CID 10825913
8,8-dimethyl-4-propan-2-ylpyrano[2,3-f]chromen-2-one (PubChem CID 10825913) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 8,8-dimethyl-4-propan-2-ylpyrano[2,3-f]chromen-2-one.
| Compound Name | 8,8-dimethyl-4-propan-2-ylpyrano[2,3-f]chromen-2-one |
|---|---|
| PubChem CID | 10825913 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 8,8-dimethyl-4-propan-2-ylpyrano[2,3-f]chromen-2-one |
| SMILES | CC(C)c1cc(=O)oc2c3c(ccc12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C17H18O3/c1-10(2)13-9-15(18)19-16-11(13)5-6-14-12(16)7-8-17(3,4)20-14/h5-10H,1-4H3 |
| InChIKey | COIAAEHPAOFGPL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|