C19H20O4 — CID 15108310
4,5,5,9,9-pentamethyl-3,8,14-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),10,16-pentaen-15-one (PubChem CID 15108310) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4,5,5,9,9-pentamethyl-3,8,14-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),10,16-pentaen-15-one.
| Compound Name | 4,5,5,9,9-pentamethyl-3,8,14-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),10,16-pentaen-15-one |
|---|---|
| PubChem CID | 15108310 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4,5,5,9,9-pentamethyl-3,8,14-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),7(12),10,16-pentaen-15-one |
| SMILES | CC1Oc2c(c3c(c4oc(=O)ccc24)C=CC(C)(C)O3)C1(C)C |
| InChI | InChI=1S/C19H20O4/c1-10-19(4,5)14-16(21-10)11-6-7-13(20)22-15(11)12-8-9-18(2,3)23-17(12)14/h6-10H,1-5H3 |
| InChIKey | XJGSKSKCCPKGNZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|