C14H12O3 — CID 53493306
2,2-dimethylpyrano[2,3-f]chromen-8-one (PubChem CID 53493306) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2,2-dimethylpyrano[2,3-f]chromen-8-one.
| Compound Name | 2,2-dimethylpyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 53493306 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2,2-dimethylpyrano[2,3-f]chromen-8-one |
| SMILES | CC1(C)C=Cc2ccc3oc(=O)ccc3c2O1 |
| InChI | InChI=1S/C14H12O3/c1-14(2)8-7-9-3-5-11-10(13(9)17-14)4-6-12(15)16-11/h3-8H,1-2H3 |
| InChIKey | VUZFFIGYQBLDCL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|