C21H24O5 — CID 508025
(16R,17R,18R)-18-methoxy-6,10,10,16,17-pentamethyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaen-4-one (PubChem CID 508025) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (16R,17R,18R)-18-methoxy-6,10,10,16,17-pentamethyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaen-4-one.
| Compound Name | (16R,17R,18R)-18-methoxy-6,10,10,16,17-pentamethyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaen-4-one |
|---|---|
| PubChem CID | 508025 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (16R,17R,18R)-18-methoxy-6,10,10,16,17-pentamethyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaen-4-one |
| SMILES | CO[C@H]1c2c(c3c(c4c(C)cc(=O)oc24)OC(C)(C)C=C3)O[C@H](C)[C@H]1C |
| InChI | InChI=1S/C21H24O5/c1-10-9-14(22)25-20-15(10)19-13(7-8-21(4,5)26-19)18-16(20)17(23-6)11(2)12(3)24-18/h7-9,11-12,17H,1-6H3/t11-,12-,17-/m1/s1 |
| InChIKey | NEHHJJDJNPBYJK-PSTGCABASA-N |
| XLogP | 4.39 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|