C23H28O4 — CID 511351
(16R,17S,18S)-18-hydroxy-10,10,16,17-tetramethyl-6-propan-2-yl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13-pentaen-4-one (PubChem CID 511351) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is (16R,17S,18S)-18-hydroxy-10,10,16,17-tetramethyl-6-propan-2-yl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13-pentaen-4-one.
| Compound Name | (16R,17S,18S)-18-hydroxy-10,10,16,17-tetramethyl-6-propan-2-yl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13-pentaen-4-one |
|---|---|
| PubChem CID | 511351 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (16R,17S,18S)-18-hydroxy-10,10,16,17-tetramethyl-6-propan-2-yl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,11,13-pentaen-4-one |
| SMILES | CC(C)c1cc(=O)oc2c3c(c4c(c12)OC(C)(C)C=C4)C[C@@H](C)[C@H](C)[C@@H]3O |
| InChI | InChI=1S/C23H28O4/c1-11(2)15-10-17(24)26-22-18-16(9-12(3)13(4)20(18)25)14-7-8-23(5,6)27-21(14)19(15)22/h7-8,10-13,20,25H,9H2,1-6H3/t12-,13+,20+/m1/s1 |
| InChIKey | NFTWIFXCCDKVEO-UVARLRKDSA-N |
| XLogP | 4.96 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|