C17H18O6 — CID 163039342
(5-methoxy-8,9,9-trimethyl-2-oxo-8H-furo[2,3-h]chromen-6-yl) acetate (PubChem CID 163039342) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is (5-methoxy-8,9,9-trimethyl-2-oxo-8H-furo[2,3-h]chromen-6-yl) acetate.
| Compound Name | (5-methoxy-8,9,9-trimethyl-2-oxo-8H-furo[2,3-h]chromen-6-yl) acetate |
|---|---|
| PubChem CID | 163039342 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (5-methoxy-8,9,9-trimethyl-2-oxo-8H-furo[2,3-h]chromen-6-yl) acetate |
| SMILES | COc1c(OC(C)=O)c2c(c3oc(=O)ccc13)C(C)(C)C(C)O2 |
| InChI | InChI=1S/C17H18O6/c1-8-17(3,4)12-13-10(6-7-11(19)23-13)14(20-5)16(15(12)21-8)22-9(2)18/h6-8H,1-5H3 |
| InChIKey | MRCNHKDHJOLFDP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|