C24H26O6 — CID 162819556
8,9-dihydroxy-4-methoxy-2,3,3-trimethyl-5-(3-methylbut-2-enyl)-2H-furo[2,3-a]xanthen-11-one (PubChem CID 162819556) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 8,9-dihydroxy-4-methoxy-2,3,3-trimethyl-5-(3-methylbut-2-enyl)-2H-furo[2,3-a]xanthen-11-one.
| Compound Name | 8,9-dihydroxy-4-methoxy-2,3,3-trimethyl-5-(3-methylbut-2-enyl)-2H-furo[2,3-a]xanthen-11-one |
|---|---|
| PubChem CID | 162819556 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 8,9-dihydroxy-4-methoxy-2,3,3-trimethyl-5-(3-methylbut-2-enyl)-2H-furo[2,3-a]xanthen-11-one |
| SMILES | COc1c2c(c3c(=O)c4cc(O)c(O)cc4oc3c1CC=C(C)C)OC(C)C2(C)C |
| InChI | InChI=1S/C24H26O6/c1-11(2)7-8-13-21-18(20(27)14-9-15(25)16(26)10-17(14)30-21)23-19(22(13)28-6)24(4,5)12(3)29-23/h7,9-10,12,25-26H,8H2,1-6H3 |
| InChIKey | CVIHMVHCWYWWPC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|