C23H24O6 — CID 162912989
(2R)-5,8,9-trihydroxy-1,1,2-trimethyl-7-(3-methylbut-2-enyl)-2H-furo[2,3-c]xanthen-6-one (PubChem CID 162912989) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2R)-5,8,9-trihydroxy-1,1,2-trimethyl-7-(3-methylbut-2-enyl)-2H-furo[2,3-c]xanthen-6-one.
| Compound Name | (2R)-5,8,9-trihydroxy-1,1,2-trimethyl-7-(3-methylbut-2-enyl)-2H-furo[2,3-c]xanthen-6-one |
|---|---|
| PubChem CID | 162912989 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (2R)-5,8,9-trihydroxy-1,1,2-trimethyl-7-(3-methylbut-2-enyl)-2H-furo[2,3-c]xanthen-6-one |
| SMILES | CC(C)=CCc1c(O)c(O)cc2oc3c4c(cc(O)c3c(=O)c12)O[C@H](C)C4(C)C |
| InChI | InChI=1S/C23H24O6/c1-10(2)6-7-12-17-15(9-14(25)20(12)26)29-22-18(21(17)27)13(24)8-16-19(22)23(4,5)11(3)28-16/h6,8-9,11,24-26H,7H2,1-5H3/t11-/m1/s1 |
| InChIKey | GIEMQAXHAKGAAH-LLVKDONJSA-N |
| XLogP | 4.63 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|