C29H30O8 — CID 163028825
4-[5,8,9-trihydroxy-2,2-dimethyl-12-(3-methylbut-2-enyl)-6-oxochromeno[7,6-b]chromen-7-yl]but-2-en-2-yl acetate (PubChem CID 163028825) has the molecular formula C29H30O8 and a molecular weight of 506.55 g/mol. Its IUPAC name is 4-[5,8,9-trihydroxy-2,2-dimethyl-12-(3-methylbut-2-enyl)-6-oxochromeno[7,6-b]chromen-7-yl]but-2-en-2-yl acetate.
| Compound Name | 4-[5,8,9-trihydroxy-2,2-dimethyl-12-(3-methylbut-2-enyl)-6-oxochromeno[7,6-b]chromen-7-yl]but-2-en-2-yl acetate |
|---|---|
| PubChem CID | 163028825 |
| Molecular Formula | C29H30O8 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-[5,8,9-trihydroxy-2,2-dimethyl-12-(3-methylbut-2-enyl)-6-oxochromeno[7,6-b]chromen-7-yl]but-2-en-2-yl acetate |
| SMILES | CC(=O)OC(C)=CCc1c(O)c(O)cc2oc3c(CC=C(C)C)c4c(c(O)c3c(=O)c12)C=CC(C)(C)O4 |
| InChI | InChI=1S/C29H30O8/c1-14(2)7-9-19-27-18(11-12-29(5,6)37-27)25(33)23-26(34)22-17(10-8-15(3)35-16(4)30)24(32)20(31)13-21(22)36-28(19)23/h7-8,11-13,31-33H,9-10H2,1-6H3 |
| InChIKey | GKFPUBZXOPADIA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|