C33H38O6 — CID 163054904
5,9,11-trihydroxy-3,3-dimethyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrano[3,2-a]xanthen-12-one (PubChem CID 163054904) has the molecular formula C33H38O6 and a molecular weight of 530.66 g/mol. Its IUPAC name is 5,9,11-trihydroxy-3,3-dimethyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrano[3,2-a]xanthen-12-one.
| Compound Name | 5,9,11-trihydroxy-3,3-dimethyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrano[3,2-a]xanthen-12-one |
|---|---|
| PubChem CID | 163054904 |
| Molecular Formula | C33H38O6 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 5,9,11-trihydroxy-3,3-dimethyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrano[3,2-a]xanthen-12-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCc1c(O)c2c(c3c(=O)c4c(O)cc(O)cc4oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C33H38O6/c1-19(2)9-7-10-20(3)11-8-12-21(4)13-14-24-29(36)32-23(15-16-33(5,6)39-32)27-30(37)28-25(35)17-22(34)18-26(28)38-31(24)27/h9,11,13,15-18,34-36H,7-8,10,12,14H2,1-6H3 |
| InChIKey | NRQUXOREHDELAQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|