C28H30O6 — CID 72792360
8-(3,7-dimethylocta-2,6-dienyl)-5,9,11-trihydroxy-3,3-dimethylpyrano[3,2-a]xanthen-12-one (PubChem CID 72792360) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is 8-(3,7-dimethylocta-2,6-dienyl)-5,9,11-trihydroxy-3,3-dimethylpyrano[3,2-a]xanthen-12-one.
| Compound Name | 8-(3,7-dimethylocta-2,6-dienyl)-5,9,11-trihydroxy-3,3-dimethylpyrano[3,2-a]xanthen-12-one |
|---|---|
| PubChem CID | 72792360 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 8-(3,7-dimethylocta-2,6-dienyl)-5,9,11-trihydroxy-3,3-dimethylpyrano[3,2-a]xanthen-12-one |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)cc(O)c2c(=O)c3c4c(c(O)cc3oc12)OC(C)(C)C=C4 |
| InChI | InChI=1S/C28H30O6/c1-15(2)7-6-8-16(3)9-10-17-19(29)13-20(30)24-25(32)23-18-11-12-28(4,5)34-26(18)21(31)14-22(23)33-27(17)24/h7,9,11-14,29-31H,6,8,10H2,1-5H3 |
| InChIKey | GOLPEIAEOMFCOY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|