C30H32O6 — CID 139077255
[12-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,2-dimethyl-6-oxopyrano[3,2-b]xanthen-8-yl] acetate (PubChem CID 139077255) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is [12-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,2-dimethyl-6-oxopyrano[3,2-b]xanthen-8-yl] acetate.
| Compound Name | [12-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,2-dimethyl-6-oxopyrano[3,2-b]xanthen-8-yl] acetate |
|---|---|
| PubChem CID | 139077255 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | [12-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,2-dimethyl-6-oxopyrano[3,2-b]xanthen-8-yl] acetate |
| SMILES | CC(=O)Oc1ccc2oc3c(C/C=C(\C)CCC=C(C)C)c4c(c(O)c3c(=O)c2c1)C=CC(C)(C)O4 |
| InChI | InChI=1S/C30H32O6/c1-17(2)8-7-9-18(3)10-12-22-28-21(14-15-30(5,6)36-28)26(32)25-27(33)23-16-20(34-19(4)31)11-13-24(23)35-29(22)25/h8,10-11,13-16,32H,7,9,12H2,1-6H3/b18-10+ |
| InChIKey | YGYNTNUBOQJBME-VCHYOVAHSA-N |
| XLogP | 7.00 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|