C23H22O6 — CID 25232301
5,9,11-trihydroxy-3,3-dimethyl-6-(3-methylbut-2-enyl)pyrano[3,2-a]xanthen-12-one (PubChem CID 25232301) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 5,9,11-trihydroxy-3,3-dimethyl-6-(3-methylbut-2-enyl)pyrano[3,2-a]xanthen-12-one.
| Compound Name | 5,9,11-trihydroxy-3,3-dimethyl-6-(3-methylbut-2-enyl)pyrano[3,2-a]xanthen-12-one |
|---|---|
| PubChem CID | 25232301 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5,9,11-trihydroxy-3,3-dimethyl-6-(3-methylbut-2-enyl)pyrano[3,2-a]xanthen-12-one |
| SMILES | CC(C)=CCc1c(O)c2c(c3c(=O)c4c(O)cc(O)cc4oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H22O6/c1-11(2)5-6-14-19(26)22-13(7-8-23(3,4)29-22)17-20(27)18-15(25)9-12(24)10-16(18)28-21(14)17/h5,7-10,24-26H,6H2,1-4H3 |
| InChIKey | IVABZOXVCKKIPH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|