C23H20O7 — CID 101266861
10,15,22-trihydroxy-7,7,18,18-tetramethyl-8,13,17-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,19,21-octaen-2-one (PubChem CID 101266861) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is 10,15,22-trihydroxy-7,7,18,18-tetramethyl-8,13,17-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,19,21-octaen-2-one.
| Compound Name | 10,15,22-trihydroxy-7,7,18,18-tetramethyl-8,13,17-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,19,21-octaen-2-one |
|---|---|
| PubChem CID | 101266861 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 10,15,22-trihydroxy-7,7,18,18-tetramethyl-8,13,17-trioxapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(14),3(12),4(9),5,10,15,19,21-octaen-2-one |
| SMILES | CC1(C)C=Cc2c(c(O)c3oc4cc(O)c5c(c4c(=O)c3c2O)C=CC(C)(C)O5)O1 |
| InChI | InChI=1S/C23H20O7/c1-22(2)7-5-10-14-13(9-12(24)19(10)29-22)28-21-15(17(14)26)16(25)11-6-8-23(3,4)30-20(11)18(21)27/h5-9,24-25,27H,1-4H3 |
| InChIKey | HGYSXMOBSMWBAD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|