C20H20O5 — CID 162857788
5-hydroxy-2,2,8-trimethyl-10-(3-methylbut-2-enoyl)pyrano[3,2-g]chromen-6-one (PubChem CID 162857788) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-hydroxy-2,2,8-trimethyl-10-(3-methylbut-2-enoyl)pyrano[3,2-g]chromen-6-one.
| Compound Name | 5-hydroxy-2,2,8-trimethyl-10-(3-methylbut-2-enoyl)pyrano[3,2-g]chromen-6-one |
|---|---|
| PubChem CID | 162857788 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-hydroxy-2,2,8-trimethyl-10-(3-methylbut-2-enoyl)pyrano[3,2-g]chromen-6-one |
| SMILES | CC(C)=CC(=O)c1c2c(c(O)c3c(=O)cc(C)oc13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C20H20O5/c1-10(2)8-13(21)16-18-12(6-7-20(4,5)25-18)17(23)15-14(22)9-11(3)24-19(15)16/h6-9,23H,1-5H3 |
| InChIKey | LYFQNGBFOUFZOD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|