C23H26O7 — CID 162922196
[(1R)-1-(6-butanoyl-5-hydroxy-2,2-dimethyl-8-oxopyrano[2,3-f]chromen-10-yl)propyl] acetate (PubChem CID 162922196) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is [(1R)-1-(6-butanoyl-5-hydroxy-2,2-dimethyl-8-oxopyrano[2,3-f]chromen-10-yl)propyl] acetate.
| Compound Name | [(1R)-1-(6-butanoyl-5-hydroxy-2,2-dimethyl-8-oxopyrano[2,3-f]chromen-10-yl)propyl] acetate |
|---|---|
| PubChem CID | 162922196 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(1R)-1-(6-butanoyl-5-hydroxy-2,2-dimethyl-8-oxopyrano[2,3-f]chromen-10-yl)propyl] acetate |
| SMILES | CCCC(=O)c1c(O)c2c(c3c([C@@H](CC)OC(C)=O)cc(=O)oc13)OC(C)(C)C=C2 |
| InChI | InChI=1S/C23H26O7/c1-6-8-15(25)19-20(27)13-9-10-23(4,5)30-21(13)18-14(11-17(26)29-22(18)19)16(7-2)28-12(3)24/h9-11,16,27H,6-8H2,1-5H3/t16-/m1/s1 |
| InChIKey | UUKLCYMJFOQPCS-MRXNPFEDSA-N |
| XLogP | 4.68 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|