About 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one
5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one (PubChem CID 90677295) has the molecular formula C22H25NO6
and a molecular weight of 399.44 g/mol. Its IUPAC name is 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one.
Molecular Properties
| Compound Name | 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one |
| PubChem CID | 90677295 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one |
| SMILES | CCCc1cc(=O)oc2c(C(=O)N3CCOCC3)c(O)c3c(c12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C22H25NO6/c1-4-5-13-12-15(24)28-20-16(13)19-14(6-7-22(2,3)29-19)18(25)17(20)21(26)23-8-10-27-11-9-23/h6-7,12,25H,4-5,8-11H2,1-3H3 |
| InChIKey | GWJIIRFITHIZMU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one?
The IUPAC name of 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one (CID 90677295) is 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one.
What is the SMILES notation for 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one?
The canonical SMILES for 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one is CCCc1cc(=O)oc2c(C(=O)N3CCOCC3)c(O)c3c(c12)OC(C)(C)C=C3.
What is the InChIKey of 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one?
The InChIKey is GWJIIRFITHIZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25NO6/c1-4-5-13-12-15(24)28-20-16(13)19-14(6-7-22(2,3)29-19)18(25)17(20)21(26)23-8-10-27-11-9-23/h6-7,12,25H,4-5,8-11H2,1-3H3.
What are the key properties of 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one?
5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one has a molecular weight of 399.44 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,2-dimethyl-6-(morpholine-4-carbonyl)-10-propylpyrano[2,3-f]chromen-8-one is sourced from PubChem (CID 90677295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).