C22H28O5 — CID 3001668
5-ethoxy-6-(1-hydroxypropyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one (PubChem CID 3001668) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is 5-ethoxy-6-(1-hydroxypropyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one.
| Compound Name | 5-ethoxy-6-(1-hydroxypropyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 3001668 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 5-ethoxy-6-(1-hydroxypropyl)-2,2-dimethyl-10-propylpyrano[2,3-f]chromen-8-one |
| SMILES | CCCc1cc(=O)oc2c(C(O)CC)c(OCC)c3c(c12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C22H28O5/c1-6-9-13-12-16(24)26-21-17(13)20-14(10-11-22(4,5)27-20)19(25-8-3)18(21)15(23)7-2/h10-12,15,23H,6-9H2,1-5H3 |
| InChIKey | AXGJKBJCZOQDTI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|