C21H30O5 — CID 5275315
8-(1-hydroxypropyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one (PubChem CID 5275315) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 8-(1-hydroxypropyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one.
| Compound Name | 8-(1-hydroxypropyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one |
|---|---|
| PubChem CID | 5275315 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 8-(1-hydroxypropyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2c(C(O)CC)c(OC(C)C)cc(OC(C)C)c12 |
| InChI | InChI=1S/C21H30O5/c1-7-9-14-10-18(23)26-21-19(14)16(24-12(3)4)11-17(25-13(5)6)20(21)15(22)8-2/h10-13,15,22H,7-9H2,1-6H3 |
| InChIKey | KAQRLELFPNEUDY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|