C22H35NO4 — CID 142170897
8-(1-aminoethyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one;ethane (PubChem CID 142170897) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is 8-(1-aminoethyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one;ethane.
| Compound Name | 8-(1-aminoethyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one;ethane |
|---|---|
| PubChem CID | 142170897 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 8-(1-aminoethyl)-5,7-di(propan-2-yloxy)-4-propylchromen-2-one;ethane |
| SMILES | CC.CCCc1cc(=O)oc2c(C(C)N)c(OC(C)C)cc(OC(C)C)c12 |
| InChI | InChI=1S/C20H29NO4.C2H6/c1-7-8-14-9-17(22)25-20-18(13(6)21)15(23-11(2)3)10-16(19(14)20)24-12(4)5;1-2/h9-13H,7-8,21H2,1-6H3;1-2H3 |
| InChIKey | VOPULJHYPZHYJW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|