C17H23NO4 — CID 5270980
8-(1-aminopropyl)-5,7-dimethoxy-4-propylchromen-2-one (PubChem CID 5270980) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 8-(1-aminopropyl)-5,7-dimethoxy-4-propylchromen-2-one.
| Compound Name | 8-(1-aminopropyl)-5,7-dimethoxy-4-propylchromen-2-one |
|---|---|
| PubChem CID | 5270980 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 8-(1-aminopropyl)-5,7-dimethoxy-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2c(C(N)CC)c(OC)cc(OC)c12 |
| InChI | InChI=1S/C17H23NO4/c1-5-7-10-8-14(19)22-17-15(10)12(20-3)9-13(21-4)16(17)11(18)6-2/h8-9,11H,5-7,18H2,1-4H3 |
| InChIKey | ZTEIEGREBBPWTD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|