C44H56O11 — CID 157479253
ethanol;5-methoxy-2,2-dimethyl-6-propanoyl-10-propyl-3,4-dihydropyrano[2,3-f]chromen-8-one;5-methoxy-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one (PubChem CID 157479253) has the molecular formula C44H56O11 and a molecular weight of 760.92 g/mol. Its IUPAC name is ethanol;5-methoxy-2,2-dimethyl-6-propanoyl-10-propyl-3,4-dihydropyrano[2,3-f]chromen-8-one;5-methoxy-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one.
| Compound Name | ethanol;5-methoxy-2,2-dimethyl-6-propanoyl-10-propyl-3,4-dihydropyrano[2,3-f]chromen-8-one;5-methoxy-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one |
|---|---|
| PubChem CID | 157479253 |
| Molecular Formula | C44H56O11 |
| Molecular Weight | 760.92 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | ethanol;5-methoxy-2,2-dimethyl-6-propanoyl-10-propyl-3,4-dihydropyrano[2,3-f]chromen-8-one;5-methoxy-2,2-dimethyl-6-propanoyl-10-propylpyrano[2,3-f]chromen-8-one |
| SMILES | CCCc1cc(=O)oc2c(C(=O)CC)c(OC)c3c(c12)OC(C)(C)C=C3.CCCc1cc(=O)oc2c(C(=O)CC)c(OC)c3c(c12)OC(C)(C)CC3.CCO |
| InChI | InChI=1S/C21H26O5.C21H24O5.C2H6O/c2*1-6-8-12-11-15(23)25-20-16(12)19-13(9-10-21(3,4)26-19)18(24-5)17(20)14(22)7-2;1-2-3/h11H,6-10H2,1-5H3;9-11H,6-8H2,1-5H3;3H,2H2,1H3 |
| InChIKey | BVYSSBACCHNTLR-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.92 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|