C24H22O5 — CID 90677252
(2,2-dimethyl-8-oxo-10-propylpyrano[2,3-f]chromen-5-yl) benzoate (PubChem CID 90677252) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is (2,2-dimethyl-8-oxo-10-propylpyrano[2,3-f]chromen-5-yl) benzoate.
| Compound Name | (2,2-dimethyl-8-oxo-10-propylpyrano[2,3-f]chromen-5-yl) benzoate |
|---|---|
| PubChem CID | 90677252 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (2,2-dimethyl-8-oxo-10-propylpyrano[2,3-f]chromen-5-yl) benzoate |
| SMILES | CCCc1cc(=O)oc2cc(OC(=O)c3ccccc3)c3c(c12)OC(C)(C)C=C3 |
| InChI | InChI=1S/C24H22O5/c1-4-8-16-13-20(25)27-19-14-18(28-23(26)15-9-6-5-7-10-15)17-11-12-24(2,3)29-22(17)21(16)19/h5-7,9-14H,4,8H2,1-3H3 |
| InChIKey | LVHJHMCNSWZOSE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|