C45H32O11 — CID 135908162
8,9-bis(9-hydroxy-3,3-dimethyl-7,10-dioxobenzo[f]chromen-8-yl)-3,3-dimethylbenzo[f]chromene-7,10-dione (PubChem CID 135908162) has the molecular formula C45H32O11 and a molecular weight of 748.74 g/mol. Its IUPAC name is 8,9-bis(9-hydroxy-3,3-dimethyl-7,10-dioxobenzo[f]chromen-8-yl)-3,3-dimethylbenzo[f]chromene-7,10-dione.
| Compound Name | 8,9-bis(9-hydroxy-3,3-dimethyl-7,10-dioxobenzo[f]chromen-8-yl)-3,3-dimethylbenzo[f]chromene-7,10-dione |
|---|---|
| PubChem CID | 135908162 |
| Molecular Formula | C45H32O11 |
| Molecular Weight | 748.74 g/mol |
| Exact Mass | 748.19 |
| IUPAC Name | 8,9-bis(9-hydroxy-3,3-dimethyl-7,10-dioxobenzo[f]chromen-8-yl)-3,3-dimethylbenzo[f]chromene-7,10-dione |
| SMILES | CC1(C)C=Cc2c(ccc3c2C(=O)C(O)=C(C2=C(C4=C(O)C(=O)c5c(ccc6c5C=CC(C)(C)O6)C4=O)C(=O)c4c(ccc5c4C=CC(C)(C)O5)C2=O)C3=O)O1 |
| InChI | InChI=1S/C45H32O11/c1-43(2)16-13-19-25(54-43)10-7-22-28(19)38(49)32(34-37(48)24-9-12-27-21(15-18-45(5,6)56-27)30(24)40(51)42(34)53)31(35(22)46)33-36(47)23-8-11-26-20(14-17-44(3,4)55-26)29(23)39(50)41(33)52/h7-18,52-53H,1-6H3 |
| InChIKey | DIAPMCYUCQBGSA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 170.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|