C30H24O6 — CID 4301466
8-(1,4-dioxonaphthalen-2-yl)-7-hydroxy-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromene-9,10-dione (PubChem CID 4301466) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 8-(1,4-dioxonaphthalen-2-yl)-7-hydroxy-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromene-9,10-dione.
| Compound Name | 8-(1,4-dioxonaphthalen-2-yl)-7-hydroxy-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromene-9,10-dione |
|---|---|
| PubChem CID | 4301466 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 8-(1,4-dioxonaphthalen-2-yl)-7-hydroxy-3-methyl-3-(4-methylpent-3-enyl)benzo[f]chromene-9,10-dione |
| SMILES | CC(C)=CCCC1(C)C=Cc2c(ccc3c2C(=O)C(=O)C(C2=CC(=O)c4ccccc4C2=O)=C3O)O1 |
| InChI | InChI=1S/C30H24O6/c1-16(2)7-6-13-30(3)14-12-19-23(36-30)11-10-20-24(19)28(34)29(35)25(27(20)33)21-15-22(31)17-8-4-5-9-18(17)26(21)32/h4-5,7-12,14-15,33H,6,13H2,1-3H3 |
| InChIKey | CHMKFRXALYUUKV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|